C12H15ClO2 — CID 82266653
1-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butan-1-one (PubChem CID 82266653) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butan-1-one.
| Compound Name | 1-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butan-1-one |
|---|---|
| PubChem CID | 82266653 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(5-chloro-2-hydroxy-3,6-dimethylphenyl)butan-1-one |
| SMILES | CCCC(=O)c1c(C)c(Cl)cc(C)c1O |
| InChI | InChI=1S/C12H15ClO2/c1-4-5-10(14)11-8(3)9(13)6-7(2)12(11)15/h6,15H,4-5H2,1-3H3 |
| InChIKey | QRQXFSCMAZOSPO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |