C10H11ClO2 — CID 82607397
1-(4-chloro-2-hydroxy-3,6-dimethylphenyl)ethanone (PubChem CID 82607397) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3,6-dimethylphenyl)ethanone.
| Compound Name | 1-(4-chloro-2-hydroxy-3,6-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 82607397 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3,6-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1c(C)cc(Cl)c(C)c1O |
| InChI | InChI=1S/C10H11ClO2/c1-5-4-8(11)6(2)10(13)9(5)7(3)12/h4,13H,1-3H3 |
| InChIKey | FZAANOLGRTYDQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |