C10H12O3 — CID 117278320
1-(2,3-dihydroxy-4,5-dimethylphenyl)ethanone (PubChem CID 117278320) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-(2,3-dihydroxy-4,5-dimethylphenyl)ethanone.
| Compound Name | 1-(2,3-dihydroxy-4,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 117278320 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-(2,3-dihydroxy-4,5-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1cc(C)c(C)c(O)c1O |
| InChI | InChI=1S/C10H12O3/c1-5-4-8(7(3)11)10(13)9(12)6(5)2/h4,12-13H,1-3H3 |
| InChIKey | OUWJBPGZDYELBC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|