C11H13NO3 — CID 14907163
1-(2,4,5-trimethyl-3-nitrophenyl)ethanone (PubChem CID 14907163) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(2,4,5-trimethyl-3-nitrophenyl)ethanone.
| Compound Name | 1-(2,4,5-trimethyl-3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 14907163 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 1-(2,4,5-trimethyl-3-nitrophenyl)ethanone |
| SMILES | CC(=O)c1cc(C)c(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H13NO3/c1-6-5-10(9(4)13)8(3)11(7(6)2)12(14)15/h5H,1-4H3 |
| InChIKey | SJOPJKDJTYHTPG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|