C9H12N2O2 — CID 826113
2,4,5-trimethyl-3-nitroaniline (PubChem CID 826113) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2,4,5-trimethyl-3-nitroaniline.
| Compound Name | 2,4,5-trimethyl-3-nitroaniline |
|---|---|
| PubChem CID | 826113 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2,4,5-trimethyl-3-nitroaniline |
| SMILES | Cc1cc(N)c(C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C9H12N2O2/c1-5-4-8(10)7(3)9(6(5)2)11(12)13/h4H,10H2,1-3H3 |
| InChIKey | JBAZTQHUQJNKTJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|