4-bromo-2,5-dimethyl-3-nitrobenzoic acid

C9H8BrNO4 — CID 89052695

IUPAC4-bromo-2,5-dimethyl-3-nitrobenzoic acid
SMILESCc1cc(C(=O)O)c(C)c([N+](=O)[O-])c1Br
InChIInChI=1S/C9H8BrNO4/c1-4-3-6(9(12)13)5(2)8(7(4)10)11(14)15/h3H,1-2H3,(H,12,13)
InChIKeyVCCASBJFEPTMCK-UHFFFAOYSA-N
MW274.07 g/mol
LogP2.67
Rot. Bonds2

About 4-bromo-2,5-dimethyl-3-nitrobenzoic acid

4-bromo-2,5-dimethyl-3-nitrobenzoic acid (PubChem CID 89052695) has the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. Its IUPAC name is 4-bromo-2,5-dimethyl-3-nitrobenzoic acid.

Molecular Properties

Compound Name4-bromo-2,5-dimethyl-3-nitrobenzoic acid
PubChem CID89052695
Molecular FormulaC9H8BrNO4
Molecular Weight274.07 g/mol
Exact Mass272.96
IUPAC Name4-bromo-2,5-dimethyl-3-nitrobenzoic acid
SMILESCc1cc(C(=O)O)c(C)c([N+](=O)[O-])c1Br
InChIInChI=1S/C9H8BrNO4/c1-4-3-6(9(12)13)5(2)8(7(4)10)11(14)15/h3H,1-2H3,(H,12,13)
InChIKeyVCCASBJFEPTMCK-UHFFFAOYSA-N
XLogP2.67
TPSA80.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.07
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-bromo-2,5-dimethyl-3-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2,5-dimethyl-3-nitrobenzoic acid?
The IUPAC name of 4-bromo-2,5-dimethyl-3-nitrobenzoic acid (CID 89052695) is 4-bromo-2,5-dimethyl-3-nitrobenzoic acid.
What is the SMILES notation for 4-bromo-2,5-dimethyl-3-nitrobenzoic acid?
The canonical SMILES for 4-bromo-2,5-dimethyl-3-nitrobenzoic acid is Cc1cc(C(=O)O)c(C)c([N+](=O)[O-])c1Br.
What is the InChIKey of 4-bromo-2,5-dimethyl-3-nitrobenzoic acid?
The InChIKey is VCCASBJFEPTMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO4/c1-4-3-6(9(12)13)5(2)8(7(4)10)11(14)15/h3H,1-2H3,(H,12,13).
What are the key properties of 4-bromo-2,5-dimethyl-3-nitrobenzoic acid?
4-bromo-2,5-dimethyl-3-nitrobenzoic acid has a molecular weight of 274.07 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,5-dimethyl-3-nitrobenzoic acid is sourced from PubChem (CID 89052695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).