C10H11BrO2 — CID 84801902
1-(4-bromo-3-hydroxy-2,5-dimethylphenyl)ethanone (PubChem CID 84801902) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 1-(4-bromo-3-hydroxy-2,5-dimethylphenyl)ethanone.
| Compound Name | 1-(4-bromo-3-hydroxy-2,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 84801902 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 1-(4-bromo-3-hydroxy-2,5-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1cc(C)c(Br)c(O)c1C |
| InChI | InChI=1S/C10H11BrO2/c1-5-4-8(7(3)12)6(2)10(13)9(5)11/h4,13H,1-3H3 |
| InChIKey | AVHRYGVCXQDKPN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |