C11H15ClO — CID 131862336
1-(2,4,6-trimethylphenyl)ethanone;hydrochloride (PubChem CID 131862336) has the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. Its IUPAC name is 1-(2,4,6-trimethylphenyl)ethanone;hydrochloride.
| Compound Name | 1-(2,4,6-trimethylphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 131862336 |
| Molecular Formula | C11H15ClO |
| Molecular Weight | 198.69 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-(2,4,6-trimethylphenyl)ethanone;hydrochloride |
| SMILES | CC(=O)c1c(C)cc(C)cc1C.Cl |
| InChI | InChI=1S/C11H14O.ClH/c1-7-5-8(2)11(10(4)12)9(3)6-7;/h5-6H,1-4H3;1H |
| InChIKey | TZIQQTZVKVLSRS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |