About CID 140911137
CID 140911137 (PubChem CID 140911137) has the molecular formula C10H11GeO
and a molecular weight of 219.81 g/mol.
Molecular Properties
| Compound Name | CID 140911137 |
| PubChem CID | 140911137 |
| Molecular Formula | C10H11GeO |
| Molecular Weight | 219.81 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(C(=O)[Ge])c(C)c1 |
| InChI | InChI=1S/C10H11GeO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3 |
| InChIKey | IZIFJBVCFLPTSP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.81 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 140911137 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140911137?
The IUPAC name of CID 140911137 (CID 140911137) is not available.
What is the SMILES notation for CID 140911137?
The canonical SMILES for CID 140911137 is Cc1cc(C)c(C(=O)[Ge])c(C)c1.
What is the InChIKey of CID 140911137?
The InChIKey is IZIFJBVCFLPTSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11GeO/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3.
What are the key properties of CID 140911137?
CID 140911137 has a molecular weight of 219.81 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140911137 is sourced from PubChem (CID 140911137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).