C10H13O3PTi — CID 175271648
dioxotitanium;phosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 175271648) has the molecular formula C10H13O3PTi and a molecular weight of 260.05 g/mol. Its IUPAC name is dioxotitanium;phosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | dioxotitanium;phosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 175271648 |
| Molecular Formula | C10H13O3PTi |
| Molecular Weight | 260.05 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | dioxotitanium;phosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)P)c(C)c1.O=[Ti]=O |
| InChI | InChI=1S/C10H13OP.2O.Ti/c1-6-4-7(2)9(10(11)12)8(3)5-6;;;/h4-5H,12H2,1-3H3;;; |
| InChIKey | NKTIHIGFWLGKFE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|