C11H15O6PS — CID 174550209
CID 174550209 (PubChem CID 174550209) has the molecular formula C11H15O6PS and a molecular weight of 306.28 g/mol.
| Compound Name | CID 174550209 |
|---|---|
| PubChem CID | 174550209 |
| Molecular Formula | C11H15O6PS |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(C(=O)C(=O)O)c(C)c1.O=S(=O)(O)P |
| InChI | InChI=1S/C11H12O3.H3O3PS/c1-6-4-7(2)9(8(3)5-6)10(12)11(13)14;1-5(2,3)4/h4-5H,1-3H3,(H,13,14);4H2,(H,1,2,3) |
| InChIKey | GVDYALKSQVHSIF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|