C24H28O7 — CID 90415261
benzoic acid;hex-3-yne-2,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid (PubChem CID 90415261) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is benzoic acid;hex-3-yne-2,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid.
| Compound Name | benzoic acid;hex-3-yne-2,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 90415261 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | benzoic acid;hex-3-yne-2,5-diol;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid |
| SMILES | CC(O)C#CC(C)O.Cc1cc(C)c(C(=O)C(=O)O)c(C)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C11H12O3.C7H6O2.C6H10O2/c1-6-4-7(2)9(8(3)5-6)10(12)11(13)14;8-7(9)6-4-2-1-3-5-6;1-5(7)3-4-6(2)8/h4-5H,1-3H3,(H,13,14);1-5H,(H,8,9);5-8H,1-2H3 |
| InChIKey | ZMAVSFSCWINDRY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|