C26H34O7 — CID 90417811
benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;3-prop-2-enylpentane-2,4-diol (PubChem CID 90417811) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;3-prop-2-enylpentane-2,4-diol.
| Compound Name | benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;3-prop-2-enylpentane-2,4-diol |
|---|---|
| PubChem CID | 90417811 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | benzoic acid;2-oxo-2-(2,4,6-trimethylphenyl)acetic acid;3-prop-2-enylpentane-2,4-diol |
| SMILES | C=CCC(C(C)O)C(C)O.Cc1cc(C)c(C(=O)C(=O)O)c(C)c1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C11H12O3.C8H16O2.C7H6O2/c1-6-4-7(2)9(8(3)5-6)10(12)11(13)14;1-4-5-8(6(2)9)7(3)10;8-7(9)6-4-2-1-3-5-6/h4-5H,1-3H3,(H,13,14);4,6-10H,1,5H2,2-3H3;1-5H,(H,8,9) |
| InChIKey | METJNTMMFQOFLR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|