C24H32O6 — CID 68742296
benzoic acid;dec-1-ene-4,6-diol (PubChem CID 68742296) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is benzoic acid;dec-1-ene-4,6-diol.
| Compound Name | benzoic acid;dec-1-ene-4,6-diol |
|---|---|
| PubChem CID | 68742296 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | benzoic acid;dec-1-ene-4,6-diol |
| SMILES | C=CCC(O)CC(O)CCCC.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C10H20O2.2C7H6O2/c1-3-5-7-10(12)8-9(11)6-4-2;2*8-7(9)6-4-2-1-3-5-6/h4,9-12H,2-3,5-8H2,1H3;2*1-5H,(H,8,9) |
| InChIKey | BDCGCKJCKFCJRO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|