C29H58O11 — CID 121434328
nonacos-1-ene-4,6,8,10,12,14,16,18,20,22,24-undecol (PubChem CID 121434328) has the molecular formula C29H58O11 and a molecular weight of 582.77 g/mol. Its IUPAC name is nonacos-1-ene-4,6,8,10,12,14,16,18,20,22,24-undecol.
| Compound Name | nonacos-1-ene-4,6,8,10,12,14,16,18,20,22,24-undecol |
|---|---|
| PubChem CID | 121434328 |
| Molecular Formula | C29H58O11 |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.40 |
| IUPAC Name | nonacos-1-ene-4,6,8,10,12,14,16,18,20,22,24-undecol |
| SMILES | C=CCC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CCCCC |
| InChI | InChI=1S/C29H58O11/c1-3-5-6-8-20(31)10-22(33)12-24(35)14-26(37)16-28(39)18-29(40)17-27(38)15-25(36)13-23(34)11-21(32)9-19(30)7-4-2/h4,19-40H,2-3,5-18H2,1H3 |
| InChIKey | YVGVJPYCCWRVLM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 222.53 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|