About (9S)-heptadec-1-en-9-ol
(9S)-heptadec-1-en-9-ol (PubChem CID 86644250) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is (9S)-heptadec-1-en-9-ol.
Molecular Properties
| Compound Name | (9S)-heptadec-1-en-9-ol |
| PubChem CID | 86644250 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | (9S)-heptadec-1-en-9-ol |
| SMILES | C=CCCCCCC[C@@H](O)CCCCCCCC |
| InChI | InChI=1S/C17H34O/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2/h3,17-18H,1,4-16H2,2H3/t17-/m1/s1 |
| InChIKey | ZNRZOZDMJDDNAZ-QGZVFWFLSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9S)-heptadec-1-en-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9S)-heptadec-1-en-9-ol?
The IUPAC name of (9S)-heptadec-1-en-9-ol (CID 86644250) is (9S)-heptadec-1-en-9-ol.
What is the SMILES notation for (9S)-heptadec-1-en-9-ol?
The canonical SMILES for (9S)-heptadec-1-en-9-ol is C=CCCCCCC[C@@H](O)CCCCCCCC.
What is the InChIKey of (9S)-heptadec-1-en-9-ol?
The InChIKey is ZNRZOZDMJDDNAZ-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H34O/c1-3-5-7-9-11-13-15-17(18)16-14-12-10-8-6-4-2/h3,17-18H,1,4-16H2,2H3/t17-/m1/s1.
What are the key properties of (9S)-heptadec-1-en-9-ol?
(9S)-heptadec-1-en-9-ol has a molecular weight of 254.46 g/mol, XLogP of 5.62, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9S)-heptadec-1-en-9-ol is sourced from PubChem (CID 86644250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).