About nonadec-18-en-7-ol
nonadec-18-en-7-ol (PubChem CID 54362965) has the molecular formula C19H38O
and a molecular weight of 282.51 g/mol. Its IUPAC name is nonadec-18-en-7-ol.
Molecular Properties
| Compound Name | nonadec-18-en-7-ol |
| PubChem CID | 54362965 |
| Molecular Formula | C19H38O |
| Molecular Weight | 282.51 g/mol |
| Exact Mass | 282.29 |
| IUPAC Name | nonadec-18-en-7-ol |
| SMILES | C=CCCCCCCCCCCC(O)CCCCCC |
| InChI | InChI=1S/C19H38O/c1-3-5-7-9-10-11-12-13-14-16-18-19(20)17-15-8-6-4-2/h3,19-20H,1,4-18H2,2H3 |
| InChIKey | SAFRWVDBCKZMES-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze nonadec-18-en-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadec-18-en-7-ol?
The IUPAC name of nonadec-18-en-7-ol (CID 54362965) is nonadec-18-en-7-ol.
What is the SMILES notation for nonadec-18-en-7-ol?
The canonical SMILES for nonadec-18-en-7-ol is C=CCCCCCCCCCCC(O)CCCCCC.
What is the InChIKey of nonadec-18-en-7-ol?
The InChIKey is SAFRWVDBCKZMES-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O/c1-3-5-7-9-10-11-12-13-14-16-18-19(20)17-15-8-6-4-2/h3,19-20H,1,4-18H2,2H3.
What are the key properties of nonadec-18-en-7-ol?
nonadec-18-en-7-ol has a molecular weight of 282.51 g/mol, XLogP of 6.40, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonadec-18-en-7-ol is sourced from PubChem (CID 54362965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).