C18H28N2O — CID 142708092
N'-[(4S)-undec-1-en-4-yl]benzohydrazide (PubChem CID 142708092) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is N'-[(4S)-undec-1-en-4-yl]benzohydrazide.
| Compound Name | N'-[(4S)-undec-1-en-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 142708092 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N'-[(4S)-undec-1-en-4-yl]benzohydrazide |
| SMILES | C=CC[C@H](CCCCCCC)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H28N2O/c1-3-5-6-7-11-15-17(12-4-2)19-20-18(21)16-13-9-8-10-14-16/h4,8-10,13-14,17,19H,2-3,5-7,11-12,15H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | SYTKNQHZXNCEGT-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|