C36H58O6 — CID 173490087
benzoic acid;5-ethenyl-7-ethylundecane;heptane-2,4-diol (PubChem CID 173490087) has the molecular formula C36H58O6 and a molecular weight of 586.85 g/mol. Its IUPAC name is benzoic acid;5-ethenyl-7-ethylundecane;heptane-2,4-diol.
| Compound Name | benzoic acid;5-ethenyl-7-ethylundecane;heptane-2,4-diol |
|---|---|
| PubChem CID | 173490087 |
| Molecular Formula | C36H58O6 |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.42 |
| IUPAC Name | benzoic acid;5-ethenyl-7-ethylundecane;heptane-2,4-diol |
| SMILES | C=CC(CCCC)CC(CC)CCCC.CCCC(O)CC(C)O.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C15H30.2C7H6O2.C7H16O2/c1-5-9-11-14(7-3)13-15(8-4)12-10-6-2;2*8-7(9)6-4-2-1-3-5-6;1-3-4-7(9)5-6(2)8/h7,14-15H,3,5-6,8-13H2,1-2,4H3;2*1-5H,(H,8,9);6-9H,3-5H2,1-2H3 |
| InChIKey | BJWBVEDNJDMAHI-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|