C24H28O5 — CID 90415366
[2,3-dimethyl-4-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxybutyl] benzoate (PubChem CID 90415366) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is [2,3-dimethyl-4-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxybutyl] benzoate.
| Compound Name | [2,3-dimethyl-4-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxybutyl] benzoate |
|---|---|
| PubChem CID | 90415366 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | [2,3-dimethyl-4-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxybutyl] benzoate |
| SMILES | Cc1cc(C)c(C(=O)C(=O)OCC(C)C(C)COC(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C24H28O5/c1-15-11-16(2)21(17(3)12-15)22(25)24(27)29-14-19(5)18(4)13-28-23(26)20-9-7-6-8-10-20/h6-12,18-19H,13-14H2,1-5H3 |
| InChIKey | HUYCSUICGWDBGY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|