C20H20O5 — CID 90415182
2-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxyethyl benzoate (PubChem CID 90415182) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxyethyl benzoate.
| Compound Name | 2-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxyethyl benzoate |
|---|---|
| PubChem CID | 90415182 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[2-oxo-2-(2,4,6-trimethylphenyl)acetyl]oxyethyl benzoate |
| SMILES | Cc1cc(C)c(C(=O)C(=O)OCCOC(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H20O5/c1-13-11-14(2)17(15(3)12-13)18(21)20(23)25-10-9-24-19(22)16-7-5-4-6-8-16/h4-8,11-12H,9-10H2,1-3H3 |
| InChIKey | UPSQTBKUJPREEU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|