C10H13O2P — CID 69266180
(2,4,6-trimethylbenzoyl)phosphinous acid (PubChem CID 69266180) has the molecular formula C10H13O2P and a molecular weight of 196.19 g/mol. Its IUPAC name is (2,4,6-trimethylbenzoyl)phosphinous acid.
| Compound Name | (2,4,6-trimethylbenzoyl)phosphinous acid |
|---|---|
| PubChem CID | 69266180 |
| Molecular Formula | C10H13O2P |
| Molecular Weight | 196.19 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (2,4,6-trimethylbenzoyl)phosphinous acid |
| SMILES | Cc1cc(C)c(C(=O)PO)c(C)c1 |
| InChI | InChI=1S/C10H13O2P/c1-6-4-7(2)9(8(3)5-6)10(11)13-12/h4-5,12-13H,1-3H3 |
| InChIKey | WKPPVJHVUSHKQN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|