C20H23O3P — CID 153324668
(3-hydroxy-2,4,6-trimethylbenzoyl)phosphanyl-(2,4,6-trimethylphenyl)methanone (PubChem CID 153324668) has the molecular formula C20H23O3P and a molecular weight of 342.38 g/mol. Its IUPAC name is (3-hydroxy-2,4,6-trimethylbenzoyl)phosphanyl-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (3-hydroxy-2,4,6-trimethylbenzoyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 153324668 |
| Molecular Formula | C20H23O3P |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (3-hydroxy-2,4,6-trimethylbenzoyl)phosphanyl-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)PC(=O)c2c(C)cc(C)c(O)c2C)c(C)c1 |
| InChI | InChI=1S/C20H23O3P/c1-10-7-11(2)16(12(3)8-10)19(22)24-20(23)17-13(4)9-14(5)18(21)15(17)6/h7-9,21,24H,1-6H3 |
| InChIKey | FMQZTCKVDCFJMH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|