C26H28ClO2P — CID 175227644
[phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;hydrochloride (PubChem CID 175227644) has the molecular formula C26H28ClO2P and a molecular weight of 438.94 g/mol. Its IUPAC name is [phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;hydrochloride.
| Compound Name | [phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 175227644 |
| Molecular Formula | C26H28ClO2P |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]-(2,4,6-trimethylphenyl)methanone;hydrochloride |
| SMILES | Cc1cc(C)c(C(=O)P(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1.Cl |
| InChI | InChI=1S/C26H27O2P.ClH/c1-16-12-18(3)23(19(4)13-16)25(27)29(22-10-8-7-9-11-22)26(28)24-20(5)14-17(2)15-21(24)6;/h7-15H,1-6H3;1H |
| InChIKey | OBKNZCJVWSNFQO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|