C29H30NO3P — CID 144597455
N-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]carbonylphenyl]methyl]prop-2-enamide (PubChem CID 144597455) has the molecular formula C29H30NO3P and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]carbonylphenyl]methyl]prop-2-enamide.
| Compound Name | N-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]carbonylphenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 144597455 |
| Molecular Formula | C29H30NO3P |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[[3,5-dimethyl-4-[phenyl-(2,4,6-trimethylbenzoyl)phosphanyl]carbonylphenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(C)c(C(=O)P(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H30NO3P/c1-7-25(31)30-17-23-15-21(5)27(22(6)16-23)29(33)34(24-11-9-8-10-12-24)28(32)26-19(3)13-18(2)14-20(26)4/h7-16H,1,17H2,2-6H3,(H,30,31) |
| InChIKey | PHOWEAIUFUYVJB-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|