C21H24N2O2 — CID 167791724
N-[[2-[2-[(3,4-dimethylphenyl)methylamino]-2-oxoethyl]phenyl]methyl]prop-2-enamide (PubChem CID 167791724) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[[2-[2-[(3,4-dimethylphenyl)methylamino]-2-oxoethyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-[2-[(3,4-dimethylphenyl)methylamino]-2-oxoethyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 167791724 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[[2-[2-[(3,4-dimethylphenyl)methylamino]-2-oxoethyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1ccccc1CC(=O)NCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-4-20(24)23-14-19-8-6-5-7-18(19)12-21(25)22-13-17-10-9-15(2)16(3)11-17/h4-11H,1,12-14H2,2-3H3,(H,22,25)(H,23,24) |
| InChIKey | UZWWZUWVDCFMLB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|