C19H21FN4O2 — CID 154875184
N-[[2-fluoro-4-[(prop-2-enoylamino)methyl]phenyl]methyl]-3,5,6-trimethylpyrazine-2-carboxamide (PubChem CID 154875184) has the molecular formula C19H21FN4O2 and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[[2-fluoro-4-[(prop-2-enoylamino)methyl]phenyl]methyl]-3,5,6-trimethylpyrazine-2-carboxamide.
| Compound Name | N-[[2-fluoro-4-[(prop-2-enoylamino)methyl]phenyl]methyl]-3,5,6-trimethylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 154875184 |
| Molecular Formula | C19H21FN4O2 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | N-[[2-fluoro-4-[(prop-2-enoylamino)methyl]phenyl]methyl]-3,5,6-trimethylpyrazine-2-carboxamide |
| SMILES | C=CC(=O)NCc1ccc(CNC(=O)c2nc(C)c(C)nc2C)c(F)c1 |
| InChI | InChI=1S/C19H21FN4O2/c1-5-17(25)21-9-14-6-7-15(16(20)8-14)10-22-19(26)18-13(4)23-11(2)12(3)24-18/h5-8H,1,9-10H2,2-4H3,(H,21,25)(H,22,26) |
| InChIKey | OGGZTLIJDMGXNT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|