C16H18ClFN4O2S — CID 154874876
N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 154874876) has the molecular formula C16H18ClFN4O2S and a molecular weight of 384.86 g/mol. Its IUPAC name is N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 154874876 |
| Molecular Formula | C16H18ClFN4O2S |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)NCc1ccc(CNC(=O)CCl)cc1F |
| InChI | InChI=1S/C16H18ClFN4O2S/c1-9(2)14-15(25-22-21-14)16(24)20-8-11-4-3-10(5-12(11)18)7-19-13(23)6-17/h3-5,9H,6-8H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | OXSQYVFRRKKSIK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|