C18H16Cl2FN3O2S — CID 154874937
N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-1,2-benzothiazole-7-carboxamide;hydrochloride (PubChem CID 154874937) has the molecular formula C18H16Cl2FN3O2S and a molecular weight of 428.32 g/mol. Its IUPAC name is N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-1,2-benzothiazole-7-carboxamide;hydrochloride.
| Compound Name | N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-1,2-benzothiazole-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154874937 |
| Molecular Formula | C18H16Cl2FN3O2S |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | N-[[4-[[(2-chloroacetyl)amino]methyl]-2-fluorophenyl]methyl]-1,2-benzothiazole-7-carboxamide;hydrochloride |
| SMILES | Cl.O=C(CCl)NCc1ccc(CNC(=O)c2cccc3cnsc23)c(F)c1 |
| InChI | InChI=1S/C18H15ClFN3O2S.ClH/c19-7-16(24)21-8-11-4-5-12(15(20)6-11)9-22-18(25)14-3-1-2-13-10-23-26-17(13)14;/h1-6,10H,7-9H2,(H,21,24)(H,22,25);1H |
| InChIKey | KWNWMVNHGYXPFT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|