C15H13F2NO — CID 110781029
N-[(3,4-difluorophenyl)methyl]-2-phenylacetamide (PubChem CID 110781029) has the molecular formula C15H13F2NO and a molecular weight of 261.27 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-2-phenylacetamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 110781029 |
| Molecular Formula | C15H13F2NO |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H13F2NO/c16-13-7-6-12(8-14(13)17)10-18-15(19)9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,18,19) |
| InChIKey | IWCVDBWHIIOMOB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |