C21H19ClN2O2 — CID 108573158
N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]naphthalene-1-carboxamide (PubChem CID 108573158) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]naphthalene-1-carboxamide.
| Compound Name | N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 108573158 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[2-[[2-(4-chlorophenyl)acetyl]amino]ethyl]naphthalene-1-carboxamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCCNC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H19ClN2O2/c22-17-10-8-15(9-11-17)14-20(25)23-12-13-24-21(26)19-7-3-5-16-4-1-2-6-18(16)19/h1-11H,12-14H2,(H,23,25)(H,24,26) |
| InChIKey | NBWLZBZEBBBRDB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|