C10H16IN3OS — CID 106846443
N-(4-iodobutyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 106846443) has the molecular formula C10H16IN3OS and a molecular weight of 353.23 g/mol. Its IUPAC name is N-(4-iodobutyl)-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-(4-iodobutyl)-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106846443 |
| Molecular Formula | C10H16IN3OS |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | N-(4-iodobutyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)NCCCCI |
| InChI | InChI=1S/C10H16IN3OS/c1-7(2)8-9(16-14-13-8)10(15)12-6-4-3-5-11/h7H,3-6H2,1-2H3,(H,12,15) |
| InChIKey | VAGLLKUONOLVFJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|