C8H12N4OS2 — CID 65204663
N-(2-amino-2-sulfanylideneethyl)-4-propan-2-ylthiadiazole-5-carboxamide (PubChem CID 65204663) has the molecular formula C8H12N4OS2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-4-propan-2-ylthiadiazole-5-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-4-propan-2-ylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204663 |
| Molecular Formula | C8H12N4OS2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-4-propan-2-ylthiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)NCC(N)=S |
| InChI | InChI=1S/C8H12N4OS2/c1-4(2)6-7(15-12-11-6)8(13)10-3-5(9)14/h4H,3H2,1-2H3,(H2,9,14)(H,10,13) |
| InChIKey | BUAFZXZGMATHHB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|