C11H14N4O3S3 — CID 65204670
4-propan-2-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiadiazole-5-carboxamide (PubChem CID 65204670) has the molecular formula C11H14N4O3S3 and a molecular weight of 346.46 g/mol. Its IUPAC name is 4-propan-2-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-propan-2-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65204670 |
| Molecular Formula | C11H14N4O3S3 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 4-propan-2-yl-N-[(5-sulfamoylthiophen-2-yl)methyl]thiadiazole-5-carboxamide |
| SMILES | CC(C)c1nnsc1C(=O)NCc1ccc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H14N4O3S3/c1-6(2)9-10(20-15-14-9)11(16)13-5-7-3-4-8(19-7)21(12,17)18/h3-4,6H,5H2,1-2H3,(H,13,16)(H2,12,17,18) |
| InChIKey | CBSBGYFHPBUVID-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |