C10H18ClN3O3S2 — CID 119270466
(2S)-2-amino-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanamide;hydrochloride (PubChem CID 119270466) has the molecular formula C10H18ClN3O3S2 and a molecular weight of 327.86 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119270466 |
| Molecular Formula | C10H18ClN3O3S2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]butanamide;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)NCc1ccc(S(N)(=O)=O)s1.Cl |
| InChI | InChI=1S/C10H17N3O3S2.ClH/c1-6(2)9(11)10(14)13-5-7-3-4-8(17-7)18(12,15)16;/h3-4,6,9H,5,11H2,1-2H3,(H,13,14)(H2,12,15,16);1H/t9-;/m0./s1 |
| InChIKey | DFYRLGIUBYHKCP-FVGYRXGTSA-N |
| XLogP | 0.42 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |