C13H21N5O3S2 — CID 119115897
4-acetyl-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 119115897) has the molecular formula C13H21N5O3S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 4-acetyl-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119115897 |
| Molecular Formula | C13H21N5O3S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-acetyl-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C13H21N5O3S2/c1-10(19)17-5-7-18(8-6-17)13(15-2)16-9-11-3-4-12(22-11)23(14,20)21/h3-4H,5-9H2,1-2H3,(H,15,16)(H2,14,20,21) |
| InChIKey | ZOKZBBKFHWQCMW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|