C14H24N4O3S2 — CID 111958145
4-ethoxy-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide (PubChem CID 111958145) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111958145 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N/C)NCc2ccc(S(N)(=O)=O)s2)CC1 |
| InChI | InChI=1S/C14H24N4O3S2/c1-3-21-11-6-8-18(9-7-11)14(16-2)17-10-12-4-5-13(22-12)23(15,19)20/h4-5,11H,3,6-10H2,1-2H3,(H,16,17)(H2,15,19,20) |
| InChIKey | OTRSYFOEOMIZOP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|