C19H26N4O3S2 — CID 109427599
N-ethyl-4-phenoxy-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide (PubChem CID 109427599) has the molecular formula C19H26N4O3S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N-ethyl-4-phenoxy-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-phenoxy-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109427599 |
| Molecular Formula | C19H26N4O3S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-ethyl-4-phenoxy-N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N4O3S2/c1-2-21-19(22-14-17-8-9-18(27-17)28(20,24)25)23-12-10-16(11-13-23)26-15-6-4-3-5-7-15/h3-9,16H,2,10-14H2,1H3,(H,21,22)(H2,20,24,25) |
| InChIKey | CULXPOXBCVZCRK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|