C17H31IN4O3S2 — CID 111958350
N'-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111958350) has the molecular formula C17H31IN4O3S2 and a molecular weight of 530.50 g/mol. Its IUPAC name is N'-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111958350 |
| Molecular Formula | C17H31IN4O3S2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N'-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-4-ethoxy-N-ethylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)s1)N1CCC(OCC)CC1.I |
| InChI | InChI=1S/C17H30N4O3S2.HI/c1-5-18-17(21-11-9-14(10-12-21)24-6-2)19-13-15-7-8-16(25-15)26(22,23)20(3)4;/h7-8,14H,5-6,9-13H2,1-4H3,(H,18,19);1H |
| InChIKey | QFERUUHVJOHYMW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|