C16H25IN4O3S2 — CID 119144865
N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide (PubChem CID 119144865) has the molecular formula C16H25IN4O3S2 and a molecular weight of 512.44 g/mol. Its IUPAC name is N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119144865 |
| Molecular Formula | C16H25IN4O3S2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | N-ethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CC2C3CCC(O3)C2C1.I |
| InChI | InChI=1S/C16H24N4O3S2.HI/c1-2-18-16(19-7-10-3-6-15(24-10)25(17,21)22)20-8-11-12(9-20)14-5-4-13(11)23-14;/h3,6,11-14H,2,4-5,7-9H2,1H3,(H,18,19)(H2,17,21,22);1H |
| InChIKey | GBDAYDZSIBYLDA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|