C15H26N4O2S2 — CID 109453788
N-ethyl-2,2,3,3-tetramethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]azetidine-1-carboximidamide (PubChem CID 109453788) has the molecular formula C15H26N4O2S2 and a molecular weight of 358.53 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453788 |
| Molecular Formula | C15H26N4O2S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-[(5-sulfamoylthiophen-2-yl)methyl]azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C15H26N4O2S2/c1-6-17-13(19-10-14(2,3)15(19,4)5)18-9-11-7-8-12(22-11)23(16,20)21/h7-8H,6,9-10H2,1-5H3,(H,17,18)(H2,16,20,21) |
| InChIKey | LXKYBBHGFXNNIC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|