C20H35N5O2S2 — CID 111292285
1-ethyl-3-[(1-piperidin-1-ylcyclohexyl)methyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111292285) has the molecular formula C20H35N5O2S2 and a molecular weight of 441.67 g/mol. Its IUPAC name is 1-ethyl-3-[(1-piperidin-1-ylcyclohexyl)methyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-piperidin-1-ylcyclohexyl)methyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111292285 |
| Molecular Formula | C20H35N5O2S2 |
| Molecular Weight | 441.67 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-ethyl-3-[(1-piperidin-1-ylcyclohexyl)methyl]-2-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(N)(=O)=O)s1)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C20H35N5O2S2/c1-2-22-19(23-15-17-9-10-18(28-17)29(21,26)27)24-16-20(11-5-3-6-12-20)25-13-7-4-8-14-25/h9-10H,2-8,11-16H2,1H3,(H2,21,26,27)(H2,22,23,24) |
| InChIKey | LIBMWSQFGFNEIM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.67 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|