C19H34N4O3S2 — CID 109476854
2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine (PubChem CID 109476854) has the molecular formula C19H34N4O3S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is 2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109476854 |
| Molecular Formula | C19H34N4O3S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 2-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)s1)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C19H34N4O3S2/c1-4-20-18(22-15-19(12-13-24)10-6-5-7-11-19)21-14-16-8-9-17(27-16)28(25,26)23(2)3/h8-9,24H,4-7,10-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | FQJWQANBAXPVKU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|