C20H35N5O — CID 109476525
2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine (PubChem CID 109476525) has the molecular formula C20H35N5O and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109476525 |
| Molecular Formula | C20H35N5O |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C20H35N5O/c1-4-21-19(23-15-17-8-12-22-18(14-17)25(2)3)24-16-20(11-13-26)9-6-5-7-10-20/h8,12,14,26H,4-7,9-11,13,15-16H2,1-3H3,(H2,21,23,24) |
| InChIKey | RQGWHOJPPCUCTJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|