C24H37N5O — CID 109478236
2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine (PubChem CID 109478236) has the molecular formula C24H37N5O and a molecular weight of 411.59 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109478236 |
| Molecular Formula | C24H37N5O |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | 2-[[2-(dimethylamino)quinolin-4-yl]methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(N(C)C)nc2ccccc12)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C24H37N5O/c1-4-25-23(27-18-24(14-15-30)12-8-5-9-13-24)26-17-19-16-22(29(2)3)28-21-11-7-6-10-20(19)21/h6-7,10-11,16,30H,4-5,8-9,12-15,17-18H2,1-3H3,(H2,25,26,27) |
| InChIKey | RGZDEOSKVPIIHJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|