C22H33N5O — CID 109477398
1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine (PubChem CID 109477398) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109477398 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccn(-c2ccccc2)n1)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C22H33N5O/c1-2-23-21(25-18-22(14-16-28)12-7-4-8-13-22)24-17-19-11-15-27(26-19)20-9-5-3-6-10-20/h3,5-6,9-11,15,28H,2,4,7-8,12-14,16-18H2,1H3,(H2,23,24,25) |
| InChIKey | PYLGYWZEDWNSSF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|