C20H30BrN5O — CID 109478031
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine (PubChem CID 109478031) has the molecular formula C20H30BrN5O and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109478031 |
| Molecular Formula | C20H30BrN5O |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cn2cc(Br)ccc2n1)NCC1(CCO)CCCCC1 |
| InChI | InChI=1S/C20H30BrN5O/c1-2-22-19(24-15-20(10-11-27)8-4-3-5-9-20)23-12-17-14-26-13-16(21)6-7-18(26)25-17/h6-7,13-14,27H,2-5,8-12,15H2,1H3,(H2,22,23,24) |
| InChIKey | SKDKIJJKYNRLPH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|