C15H20BrN5O2S — CID 111140181
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine (PubChem CID 111140181) has the molecular formula C15H20BrN5O2S and a molecular weight of 414.33 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111140181 |
| Molecular Formula | C15H20BrN5O2S |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-(1,1-dioxothiolan-3-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1cn2cc(Br)ccc2n1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H20BrN5O2S/c1-2-17-15(20-12-5-6-24(22,23)10-12)18-7-13-9-21-8-11(16)3-4-14(21)19-13/h3-4,8-9,12H,2,5-7,10H2,1H3,(H2,17,18,20) |
| InChIKey | CNFDLKGFZRNNHH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|