C17H24BrN5S — CID 111530751
2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530751) has the molecular formula C17H24BrN5S and a molecular weight of 410.39 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530751 |
| Molecular Formula | C17H24BrN5S |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCN/C(=N\Cc1cn2cc(Br)ccc2n1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C17H24BrN5S/c1-3-19-17(22-13-5-6-15(8-13)24-2)20-9-14-11-23-10-12(18)4-7-16(23)21-14/h4,7,10-11,13,15H,3,5-6,8-9H2,1-2H3,(H2,19,20,22) |
| InChIKey | GLIJUTTWEOWKDS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|