C18H28BrIN6O — CID 111941492
3-[[N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111941492) has the molecular formula C18H28BrIN6O and a molecular weight of 551.27 g/mol. Its IUPAC name is 3-[[N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111941492 |
| Molecular Formula | C18H28BrIN6O |
| Molecular Weight | 551.27 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | 3-[[N'-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cn2cc(Br)ccc2n1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C18H27BrN6O.HI/c1-4-20-18(21-10-9-17(26)24(5-2)6-3)22-11-15-13-25-12-14(19)7-8-16(25)23-15;/h7-8,12-13H,4-6,9-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | RJQVULLIHPGKFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|